C6H7NO2 — CID 19420326
1-azabicyclo[3.2.0]heptane-4,7-dione (PubChem CID 19420326) has the molecular formula C6H7NO2 and a molecular weight of 125.13 g/mol. Its IUPAC name is 1-azabicyclo[3.2.0]heptane-4,7-dione.
| Compound Name | 1-azabicyclo[3.2.0]heptane-4,7-dione |
|---|---|
| PubChem CID | 19420326 |
| Molecular Formula | C6H7NO2 |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.05 |
| IUPAC Name | 1-azabicyclo[3.2.0]heptane-4,7-dione |
| SMILES | O=C1CCN2C(=O)CC12 |
| InChI | InChI=1S/C6H7NO2/c8-5-1-2-7-4(5)3-6(7)9/h4H,1-3H2 |
| InChIKey | HDJIBPIRWZKGNK-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |