C22H25F2NO3 — CID 19424119
2-(2,6-difluorophenyl)-4-[[4-(2-ethoxyethyl)-2,3-dimethylphenoxy]methyl]-4,5-dihydro-1,3-oxazole (PubChem CID 19424119) has the molecular formula C22H25F2NO3 and a molecular weight of 389.44 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-4-[[4-(2-ethoxyethyl)-2,3-dimethylphenoxy]methyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(2,6-difluorophenyl)-4-[[4-(2-ethoxyethyl)-2,3-dimethylphenoxy]methyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 19424119 |
| Molecular Formula | C22H25F2NO3 |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 2-(2,6-difluorophenyl)-4-[[4-(2-ethoxyethyl)-2,3-dimethylphenoxy]methyl]-4,5-dihydro-1,3-oxazole |
| SMILES | CCOCCc1ccc(OCC2COC(c3c(F)cccc3F)=N2)c(C)c1C |
| InChI | InChI=1S/C22H25F2NO3/c1-4-26-11-10-16-8-9-20(15(3)14(16)2)27-12-17-13-28-22(25-17)21-18(23)6-5-7-19(21)24/h5-9,17H,4,10-13H2,1-3H3 |
| InChIKey | VBKKEQCPSWZBIY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|