C26H31NO2S — CID 19424261
(6-hydroxy-2-propan-2-yl-1-benzothiophen-3-yl)-[4-(4-pyrrolidin-1-ylbutyl)phenyl]methanone (PubChem CID 19424261) has the molecular formula C26H31NO2S and a molecular weight of 421.61 g/mol. Its IUPAC name is (6-hydroxy-2-propan-2-yl-1-benzothiophen-3-yl)-[4-(4-pyrrolidin-1-ylbutyl)phenyl]methanone.
| Compound Name | (6-hydroxy-2-propan-2-yl-1-benzothiophen-3-yl)-[4-(4-pyrrolidin-1-ylbutyl)phenyl]methanone |
|---|---|
| PubChem CID | 19424261 |
| Molecular Formula | C26H31NO2S |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | (6-hydroxy-2-propan-2-yl-1-benzothiophen-3-yl)-[4-(4-pyrrolidin-1-ylbutyl)phenyl]methanone |
| SMILES | CC(C)c1sc2cc(O)ccc2c1C(=O)c1ccc(CCCCN2CCCC2)cc1 |
| InChI | InChI=1S/C26H31NO2S/c1-18(2)26-24(22-13-12-21(28)17-23(22)30-26)25(29)20-10-8-19(9-11-20)7-3-4-14-27-15-5-6-16-27/h8-13,17-18,28H,3-7,14-16H2,1-2H3 |
| InChIKey | WSCPUYNDTXDIJO-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|