C21H30N2 — CID 19427061
N'-(3,5-dimethyl-1-adamantyl)-N-(2-methylphenyl)ethanimidamide (PubChem CID 19427061) has the molecular formula C21H30N2 and a molecular weight of 310.48 g/mol. Its IUPAC name is N'-(3,5-dimethyl-1-adamantyl)-N-(2-methylphenyl)ethanimidamide.
| Compound Name | N'-(3,5-dimethyl-1-adamantyl)-N-(2-methylphenyl)ethanimidamide |
|---|---|
| PubChem CID | 19427061 |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | N'-(3,5-dimethyl-1-adamantyl)-N-(2-methylphenyl)ethanimidamide |
| SMILES | C/C(=N\C12CC3CC(C)(CC(C)(C3)C1)C2)Nc1ccccc1C |
| InChI | InChI=1S/C21H30N2/c1-15-7-5-6-8-18(15)22-16(2)23-21-11-17-9-19(3,13-21)12-20(4,10-17)14-21/h5-8,17H,9-14H2,1-4H3,(H,22,23) |
| InChIKey | VILLRTMIQRDMGB-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|