About 2-(3,5-dimethyl-1-adamantyl)-1-hydroxyguanidine
2-(3,5-dimethyl-1-adamantyl)-1-hydroxyguanidine (PubChem CID 79986526) has the molecular formula C13H23N3O
and a molecular weight of 237.35 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-adamantyl)-1-hydroxyguanidine.
Molecular Properties
| Compound Name | 2-(3,5-dimethyl-1-adamantyl)-1-hydroxyguanidine |
| PubChem CID | 79986526 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 2-(3,5-dimethyl-1-adamantyl)-1-hydroxyguanidine |
| SMILES | CC12CC3CC(C)(C1)CC(/N=C(\N)NO)(C3)C2 |
| InChI | InChI=1S/C13H23N3O/c1-11-3-9-4-12(2,6-11)8-13(5-9,7-11)15-10(14)16-17/h9,17H,3-8H2,1-2H3,(H3,14,15,16) |
| InChIKey | YYBUCQOPDGEGLA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-dimethyl-1-adamantyl)-1-hydroxyguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethyl-1-adamantyl)-1-hydroxyguanidine?
The IUPAC name of 2-(3,5-dimethyl-1-adamantyl)-1-hydroxyguanidine (CID 79986526) is 2-(3,5-dimethyl-1-adamantyl)-1-hydroxyguanidine.
What is the SMILES notation for 2-(3,5-dimethyl-1-adamantyl)-1-hydroxyguanidine?
The canonical SMILES for 2-(3,5-dimethyl-1-adamantyl)-1-hydroxyguanidine is CC12CC3CC(C)(C1)CC(/N=C(\N)NO)(C3)C2.
What is the InChIKey of 2-(3,5-dimethyl-1-adamantyl)-1-hydroxyguanidine?
The InChIKey is YYBUCQOPDGEGLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O/c1-11-3-9-4-12(2,6-11)8-13(5-9,7-11)15-10(14)16-17/h9,17H,3-8H2,1-2H3,(H3,14,15,16).
What are the key properties of 2-(3,5-dimethyl-1-adamantyl)-1-hydroxyguanidine?
2-(3,5-dimethyl-1-adamantyl)-1-hydroxyguanidine has a molecular weight of 237.35 g/mol, XLogP of 2.03, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethyl-1-adamantyl)-1-hydroxyguanidine is sourced from PubChem (CID 79986526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).