About 8,8-difluorooct-7-enoic acid
8,8-difluorooct-7-enoic acid (PubChem CID 19430082) has the molecular formula C8H12F2O2
and a molecular weight of 178.18 g/mol. Its IUPAC name is 8,8-difluorooct-7-enoic acid.
Molecular Properties
| Compound Name | 8,8-difluorooct-7-enoic acid |
| PubChem CID | 19430082 |
| Molecular Formula | C8H12F2O2 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 8,8-difluorooct-7-enoic acid |
| SMILES | O=C(O)CCCCCC=C(F)F |
| InChI | InChI=1S/C8H12F2O2/c9-7(10)5-3-1-2-4-6-8(11)12/h5H,1-4,6H2,(H,11,12) |
| InChIKey | BCTBFXNYZBHIKE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8,8-difluorooct-7-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-difluorooct-7-enoic acid?
The IUPAC name of 8,8-difluorooct-7-enoic acid (CID 19430082) is 8,8-difluorooct-7-enoic acid.
What is the SMILES notation for 8,8-difluorooct-7-enoic acid?
The canonical SMILES for 8,8-difluorooct-7-enoic acid is O=C(O)CCCCCC=C(F)F.
What is the InChIKey of 8,8-difluorooct-7-enoic acid?
The InChIKey is BCTBFXNYZBHIKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2O2/c9-7(10)5-3-1-2-4-6-8(11)12/h5H,1-4,6H2,(H,11,12).
What are the key properties of 8,8-difluorooct-7-enoic acid?
8,8-difluorooct-7-enoic acid has a molecular weight of 178.18 g/mol, XLogP of 2.80, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-difluorooct-7-enoic acid is sourced from PubChem (CID 19430082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).