C30H31ClFN5O6S — CID 19432633
1-[2-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-chloro-5-methoxyphenoxy)pyrimidin-4-yl]oxyethyl]-3-(2-fluorophenyl)urea (PubChem CID 19432633) has the molecular formula C30H31ClFN5O6S and a molecular weight of 644.13 g/mol. Its IUPAC name is 1-[2-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-chloro-5-methoxyphenoxy)pyrimidin-4-yl]oxyethyl]-3-(2-fluorophenyl)urea.
| Compound Name | 1-[2-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-chloro-5-methoxyphenoxy)pyrimidin-4-yl]oxyethyl]-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 19432633 |
| Molecular Formula | C30H31ClFN5O6S |
| Molecular Weight | 644.13 g/mol |
| Exact Mass | 643.17 |
| IUPAC Name | 1-[2-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-chloro-5-methoxyphenoxy)pyrimidin-4-yl]oxyethyl]-3-(2-fluorophenyl)urea |
| SMILES | COc1ccc(Cl)c(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCNC(=O)Nc2ccccc2F)c1 |
| InChI | InChI=1S/C30H31ClFN5O6S/c1-30(2,3)19-9-12-21(13-10-19)44(39,40)37-27-26(43-25-17-20(41-4)11-14-22(25)31)28(35-18-34-27)42-16-15-33-29(38)36-24-8-6-5-7-23(24)32/h5-14,17-18H,15-16H2,1-4H3,(H2,33,36,38)(H,34,35,37) |
| InChIKey | IUJNOQJFFQVUEO-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 140.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.13 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|