C28H29ClN6O7S — CID 54399372
2-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-chloro-5-methoxyphenoxy)pyrimidin-4-yl]oxyethyl N-pyrazin-2-ylcarbamate (PubChem CID 54399372) has the molecular formula C28H29ClN6O7S and a molecular weight of 629.10 g/mol. Its IUPAC name is 2-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-chloro-5-methoxyphenoxy)pyrimidin-4-yl]oxyethyl N-pyrazin-2-ylcarbamate.
| Compound Name | 2-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-chloro-5-methoxyphenoxy)pyrimidin-4-yl]oxyethyl N-pyrazin-2-ylcarbamate |
|---|---|
| PubChem CID | 54399372 |
| Molecular Formula | C28H29ClN6O7S |
| Molecular Weight | 629.10 g/mol |
| Exact Mass | 628.15 |
| IUPAC Name | 2-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-chloro-5-methoxyphenoxy)pyrimidin-4-yl]oxyethyl N-pyrazin-2-ylcarbamate |
| SMILES | COc1ccc(Cl)c(Oc2c(NS(=O)(=O)c3ccc(C(C)(C)C)cc3)ncnc2OCCOC(=O)Nc2cnccn2)c1 |
| InChI | InChI=1S/C28H29ClN6O7S/c1-28(2,3)18-5-8-20(9-6-18)43(37,38)35-25-24(42-22-15-19(39-4)7-10-21(22)29)26(33-17-32-25)40-13-14-41-27(36)34-23-16-30-11-12-31-23/h5-12,15-17H,13-14H2,1-4H3,(H,31,34,36)(H,32,33,35) |
| InChIKey | VMHSAPSFJIZZAF-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 163.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.10 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|