C27H23ClN4O10S — CID 139648797
2-[6-(1,3-benzodioxol-5-ylsulfonylamino)-5-(2-chloro-5-methoxyphenoxy)pyrimidin-4-yl]oxyethyl pyridin-2-ylmethyl carbonate (PubChem CID 139648797) has the molecular formula C27H23ClN4O10S and a molecular weight of 631.02 g/mol. Its IUPAC name is 2-[6-(1,3-benzodioxol-5-ylsulfonylamino)-5-(2-chloro-5-methoxyphenoxy)pyrimidin-4-yl]oxyethyl pyridin-2-ylmethyl carbonate.
| Compound Name | 2-[6-(1,3-benzodioxol-5-ylsulfonylamino)-5-(2-chloro-5-methoxyphenoxy)pyrimidin-4-yl]oxyethyl pyridin-2-ylmethyl carbonate |
|---|---|
| PubChem CID | 139648797 |
| Molecular Formula | C27H23ClN4O10S |
| Molecular Weight | 631.02 g/mol |
| Exact Mass | 630.08 |
| IUPAC Name | 2-[6-(1,3-benzodioxol-5-ylsulfonylamino)-5-(2-chloro-5-methoxyphenoxy)pyrimidin-4-yl]oxyethyl pyridin-2-ylmethyl carbonate |
| SMILES | COc1ccc(Cl)c(Oc2c(NS(=O)(=O)c3ccc4c(c3)OCO4)ncnc2OCCOC(=O)OCc2ccccn2)c1 |
| InChI | InChI=1S/C27H23ClN4O10S/c1-36-18-5-7-20(28)22(12-18)42-24-25(32-43(34,35)19-6-8-21-23(13-19)41-16-40-21)30-15-31-26(24)37-10-11-38-27(33)39-14-17-4-2-3-9-29-17/h2-9,12-13,15H,10-11,14,16H2,1H3,(H,30,31,32) |
| InChIKey | AHXPCVBXQSEBCZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 166.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.02 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|