C32H33ClN4O9S — CID 150874019
methyl 2-[2-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-chloro-5-methoxyphenoxy)pyrimidin-4-yl]oxyethoxycarbonylamino]benzoate (PubChem CID 150874019) has the molecular formula C32H33ClN4O9S and a molecular weight of 685.16 g/mol. Its IUPAC name is methyl 2-[2-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-chloro-5-methoxyphenoxy)pyrimidin-4-yl]oxyethoxycarbonylamino]benzoate.
| Compound Name | methyl 2-[2-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-chloro-5-methoxyphenoxy)pyrimidin-4-yl]oxyethoxycarbonylamino]benzoate |
|---|---|
| PubChem CID | 150874019 |
| Molecular Formula | C32H33ClN4O9S |
| Molecular Weight | 685.16 g/mol |
| Exact Mass | 684.17 |
| IUPAC Name | methyl 2-[2-[6-[(4-tert-butylphenyl)sulfonylamino]-5-(2-chloro-5-methoxyphenoxy)pyrimidin-4-yl]oxyethoxycarbonylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)OCCOc1ncnc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c1Oc1cc(OC)ccc1Cl |
| InChI | InChI=1S/C32H33ClN4O9S/c1-32(2,3)20-10-13-22(14-11-20)47(40,41)37-28-27(46-26-18-21(42-4)12-15-24(26)33)29(35-19-34-28)44-16-17-45-31(39)36-25-9-7-6-8-23(25)30(38)43-5/h6-15,18-19H,16-17H2,1-5H3,(H,36,39)(H,34,35,37) |
| InChIKey | KUPXMVQXFXABKZ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 164.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.16 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|