C18H15F3N2O3 — CID 19434791
5-amino-6,8-difluoro-2-[3-fluoro-4-(2-methoxyethylamino)phenyl]chromen-4-one (PubChem CID 19434791) has the molecular formula C18H15F3N2O3 and a molecular weight of 364.32 g/mol. Its IUPAC name is 5-amino-6,8-difluoro-2-[3-fluoro-4-(2-methoxyethylamino)phenyl]chromen-4-one.
| Compound Name | 5-amino-6,8-difluoro-2-[3-fluoro-4-(2-methoxyethylamino)phenyl]chromen-4-one |
|---|---|
| PubChem CID | 19434791 |
| Molecular Formula | C18H15F3N2O3 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 5-amino-6,8-difluoro-2-[3-fluoro-4-(2-methoxyethylamino)phenyl]chromen-4-one |
| SMILES | COCCNc1ccc(-c2cc(=O)c3c(N)c(F)cc(F)c3o2)cc1F |
| InChI | InChI=1S/C18H15F3N2O3/c1-25-5-4-23-13-3-2-9(6-10(13)19)15-8-14(24)16-17(22)11(20)7-12(21)18(16)26-15/h2-3,6-8,23H,4-5,22H2,1H3 |
| InChIKey | QZEZMABXDJMCIY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|