About carbonyl dicyanide;(3-nitrophenyl)hydrazine
carbonyl dicyanide;(3-nitrophenyl)hydrazine (PubChem CID 19436738) has the molecular formula C9H7N5O3
and a molecular weight of 233.19 g/mol. Its IUPAC name is carbonyl dicyanide;(3-nitrophenyl)hydrazine.
Molecular Properties
| Compound Name | carbonyl dicyanide;(3-nitrophenyl)hydrazine |
| PubChem CID | 19436738 |
| Molecular Formula | C9H7N5O3 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | carbonyl dicyanide;(3-nitrophenyl)hydrazine |
| SMILES | N#CC(=O)C#N.NNc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H7N3O2.C3N2O/c7-8-5-2-1-3-6(4-5)9(10)11;4-1-3(6)2-5/h1-4,8H,7H2; |
| InChIKey | BRMMYNVSXWDVHM-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 145.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze carbonyl dicyanide;(3-nitrophenyl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonyl dicyanide;(3-nitrophenyl)hydrazine?
The IUPAC name of carbonyl dicyanide;(3-nitrophenyl)hydrazine (CID 19436738) is carbonyl dicyanide;(3-nitrophenyl)hydrazine.
What is the SMILES notation for carbonyl dicyanide;(3-nitrophenyl)hydrazine?
The canonical SMILES for carbonyl dicyanide;(3-nitrophenyl)hydrazine is N#CC(=O)C#N.NNc1cccc([N+](=O)[O-])c1.
What is the InChIKey of carbonyl dicyanide;(3-nitrophenyl)hydrazine?
The InChIKey is BRMMYNVSXWDVHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O2.C3N2O/c7-8-5-2-1-3-6(4-5)9(10)11;4-1-3(6)2-5/h1-4,8H,7H2;.
What are the key properties of carbonyl dicyanide;(3-nitrophenyl)hydrazine?
carbonyl dicyanide;(3-nitrophenyl)hydrazine has a molecular weight of 233.19 g/mol, XLogP of 0.48, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for carbonyl dicyanide;(3-nitrophenyl)hydrazine is sourced from PubChem (CID 19436738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).