C21H20Cl2N2O2S — CID 19437836
3-[2-[4-(3,4-dichlorobenzoyl)piperidin-1-yl]ethyl]-1,3-benzothiazol-2-one (PubChem CID 19437836) has the molecular formula C21H20Cl2N2O2S and a molecular weight of 435.38 g/mol. Its IUPAC name is 3-[2-[4-(3,4-dichlorobenzoyl)piperidin-1-yl]ethyl]-1,3-benzothiazol-2-one.
| Compound Name | 3-[2-[4-(3,4-dichlorobenzoyl)piperidin-1-yl]ethyl]-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 19437836 |
| Molecular Formula | C21H20Cl2N2O2S |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 3-[2-[4-(3,4-dichlorobenzoyl)piperidin-1-yl]ethyl]-1,3-benzothiazol-2-one |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)C1CCN(CCn2c(=O)sc3ccccc32)CC1 |
| InChI | InChI=1S/C21H20Cl2N2O2S/c22-16-6-5-15(13-17(16)23)20(26)14-7-9-24(10-8-14)11-12-25-18-3-1-2-4-19(18)28-21(25)27/h1-6,13-14H,7-12H2 |
| InChIKey | QEWKCOZLFHUCHT-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |