C22H27N7OS — CID 19445726
1-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]-3-[1-methyl-5-(piperidine-1-carbonyl)pyrazol-4-yl]thiourea (PubChem CID 19445726) has the molecular formula C22H27N7OS and a molecular weight of 437.57 g/mol. Its IUPAC name is 1-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]-3-[1-methyl-5-(piperidine-1-carbonyl)pyrazol-4-yl]thiourea.
| Compound Name | 1-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]-3-[1-methyl-5-(piperidine-1-carbonyl)pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19445726 |
| Molecular Formula | C22H27N7OS |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 1-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]-3-[1-methyl-5-(piperidine-1-carbonyl)pyrazol-4-yl]thiourea |
| SMILES | Cc1ccc(Cn2cc(NC(=S)Nc3cnn(C)c3C(=O)N3CCCCC3)cn2)cc1 |
| InChI | InChI=1S/C22H27N7OS/c1-16-6-8-17(9-7-16)14-29-15-18(12-24-29)25-22(31)26-19-13-23-27(2)20(19)21(30)28-10-4-3-5-11-28/h6-9,12-13,15H,3-5,10-11,14H2,1-2H3,(H2,25,26,31) |
| InChIKey | NDKOPXWDPWGZGG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|