C18H32N6OS — CID 19445685
1-[3-(diethylamino)propyl]-3-[1-methyl-5-(piperidine-1-carbonyl)pyrazol-4-yl]thiourea (PubChem CID 19445685) has the molecular formula C18H32N6OS and a molecular weight of 380.56 g/mol. Its IUPAC name is 1-[3-(diethylamino)propyl]-3-[1-methyl-5-(piperidine-1-carbonyl)pyrazol-4-yl]thiourea.
| Compound Name | 1-[3-(diethylamino)propyl]-3-[1-methyl-5-(piperidine-1-carbonyl)pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19445685 |
| Molecular Formula | C18H32N6OS |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | 1-[3-(diethylamino)propyl]-3-[1-methyl-5-(piperidine-1-carbonyl)pyrazol-4-yl]thiourea |
| SMILES | CCN(CC)CCCNC(=S)Nc1cnn(C)c1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C18H32N6OS/c1-4-23(5-2)11-9-10-19-18(26)21-15-14-20-22(3)16(15)17(25)24-12-7-6-8-13-24/h14H,4-13H2,1-3H3,(H2,19,21,26) |
| InChIKey | JCQIPWKQDMIVGL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|