C25H34N4OS — CID 100738747
1-[3-(N-ethyl-4-methylanilino)propyl]-3-[4-(piperidine-1-carbonyl)phenyl]thiourea (PubChem CID 100738747) has the molecular formula C25H34N4OS and a molecular weight of 438.64 g/mol. Its IUPAC name is 1-[3-(N-ethyl-4-methylanilino)propyl]-3-[4-(piperidine-1-carbonyl)phenyl]thiourea.
| Compound Name | 1-[3-(N-ethyl-4-methylanilino)propyl]-3-[4-(piperidine-1-carbonyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100738747 |
| Molecular Formula | C25H34N4OS |
| Molecular Weight | 438.64 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 1-[3-(N-ethyl-4-methylanilino)propyl]-3-[4-(piperidine-1-carbonyl)phenyl]thiourea |
| SMILES | CCN(CCCNC(=S)Nc1ccc(C(=O)N2CCCCC2)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H34N4OS/c1-3-28(23-14-8-20(2)9-15-23)19-7-16-26-25(31)27-22-12-10-21(11-13-22)24(30)29-17-5-4-6-18-29/h8-15H,3-7,16-19H2,1-2H3,(H2,26,27,31) |
| InChIKey | BLHRULMEODFHJZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.64 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thio_urea_A(12)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|