C24H29N5O4 — CID 19337046
6-(1,3-dioxoisoindol-2-yl)-N-[1-methyl-5-(piperidine-1-carbonyl)pyrazol-4-yl]hexanamide (PubChem CID 19337046) has the molecular formula C24H29N5O4 and a molecular weight of 451.53 g/mol. Its IUPAC name is 6-(1,3-dioxoisoindol-2-yl)-N-[1-methyl-5-(piperidine-1-carbonyl)pyrazol-4-yl]hexanamide.
| Compound Name | 6-(1,3-dioxoisoindol-2-yl)-N-[1-methyl-5-(piperidine-1-carbonyl)pyrazol-4-yl]hexanamide |
|---|---|
| PubChem CID | 19337046 |
| Molecular Formula | C24H29N5O4 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 6-(1,3-dioxoisoindol-2-yl)-N-[1-methyl-5-(piperidine-1-carbonyl)pyrazol-4-yl]hexanamide |
| SMILES | Cn1ncc(NC(=O)CCCCCN2C(=O)c3ccccc3C2=O)c1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C24H29N5O4/c1-27-21(24(33)28-13-7-3-8-14-28)19(16-25-27)26-20(30)12-4-2-9-15-29-22(31)17-10-5-6-11-18(17)23(29)32/h5-6,10-11,16H,2-4,7-9,12-15H2,1H3,(H,26,30) |
| InChIKey | HJZAESSEMIMQTD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 104.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|