C17H19ClFN5O2S — CID 19445753
1-(3-chloro-4-fluorophenyl)-3-[1-ethyl-5-(morpholine-4-carbonyl)pyrazol-4-yl]thiourea (PubChem CID 19445753) has the molecular formula C17H19ClFN5O2S and a molecular weight of 411.89 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[1-ethyl-5-(morpholine-4-carbonyl)pyrazol-4-yl]thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[1-ethyl-5-(morpholine-4-carbonyl)pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19445753 |
| Molecular Formula | C17H19ClFN5O2S |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[1-ethyl-5-(morpholine-4-carbonyl)pyrazol-4-yl]thiourea |
| SMILES | CCn1ncc(NC(=S)Nc2ccc(F)c(Cl)c2)c1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C17H19ClFN5O2S/c1-2-24-15(16(25)23-5-7-26-8-6-23)14(10-20-24)22-17(27)21-11-3-4-13(19)12(18)9-11/h3-4,9-10H,2,5-8H2,1H3,(H2,21,22,27) |
| InChIKey | GKNKKSNTGJBLMV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|