C23H33N5O4S — CID 19445755
1-[2-(3,4-diethoxyphenyl)ethyl]-3-[1-ethyl-5-(morpholine-4-carbonyl)pyrazol-4-yl]thiourea (PubChem CID 19445755) has the molecular formula C23H33N5O4S and a molecular weight of 475.62 g/mol. Its IUPAC name is 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[1-ethyl-5-(morpholine-4-carbonyl)pyrazol-4-yl]thiourea.
| Compound Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[1-ethyl-5-(morpholine-4-carbonyl)pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19445755 |
| Molecular Formula | C23H33N5O4S |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[1-ethyl-5-(morpholine-4-carbonyl)pyrazol-4-yl]thiourea |
| SMILES | CCOc1ccc(CCNC(=S)Nc2cnn(CC)c2C(=O)N2CCOCC2)cc1OCC |
| InChI | InChI=1S/C23H33N5O4S/c1-4-28-21(22(29)27-11-13-30-14-12-27)18(16-25-28)26-23(33)24-10-9-17-7-8-19(31-5-2)20(15-17)32-6-3/h7-8,15-16H,4-6,9-14H2,1-3H3,(H2,24,26,33) |
| InChIKey | NVEVLPBYWBXQPQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|