C14H17ClFN3O2S — CID 9095606
3-(3-chloro-4-fluorophenyl)-1-methyl-1-(2-morpholin-4-yl-2-oxoethyl)thiourea (PubChem CID 9095606) has the molecular formula C14H17ClFN3O2S and a molecular weight of 345.83 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-1-methyl-1-(2-morpholin-4-yl-2-oxoethyl)thiourea.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-1-methyl-1-(2-morpholin-4-yl-2-oxoethyl)thiourea |
|---|---|
| PubChem CID | 9095606 |
| Molecular Formula | C14H17ClFN3O2S |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-1-methyl-1-(2-morpholin-4-yl-2-oxoethyl)thiourea |
| SMILES | CN(CC(=O)N1CCOCC1)C(=S)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H17ClFN3O2S/c1-18(9-13(20)19-4-6-21-7-5-19)14(22)17-10-2-3-12(16)11(15)8-10/h2-3,8H,4-7,9H2,1H3,(H,17,22) |
| InChIKey | RYOOZDCCORDWSR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|