C24H18F3N5O4 — CID 19451295
5-cyclopropyl-N-[3-(4-methylphenoxy)-5-nitrophenyl]-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 19451295) has the molecular formula C24H18F3N5O4 and a molecular weight of 497.43 g/mol. Its IUPAC name is 5-cyclopropyl-N-[3-(4-methylphenoxy)-5-nitrophenyl]-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 5-cyclopropyl-N-[3-(4-methylphenoxy)-5-nitrophenyl]-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 19451295 |
| Molecular Formula | C24H18F3N5O4 |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 5-cyclopropyl-N-[3-(4-methylphenoxy)-5-nitrophenyl]-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | Cc1ccc(Oc2cc(NC(=O)c3cnn4c(C(F)(F)F)cc(C5CC5)nc34)cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C24H18F3N5O4/c1-13-2-6-17(7-3-13)36-18-9-15(8-16(10-18)32(34)35)29-23(33)19-12-28-31-21(24(25,26)27)11-20(14-4-5-14)30-22(19)31/h2-3,6-12,14H,4-5H2,1H3,(H,29,33) |
| InChIKey | UCJRRFZACPNPRC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|