C25H20F5N5O4 — CID 19457761
N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-5-(4-propan-2-ylphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 19457761) has the molecular formula C25H20F5N5O4 and a molecular weight of 549.46 g/mol. Its IUPAC name is N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-5-(4-propan-2-ylphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-5-(4-propan-2-ylphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 19457761 |
| Molecular Formula | C25H20F5N5O4 |
| Molecular Weight | 549.46 g/mol |
| Exact Mass | 549.14 |
| IUPAC Name | N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-5-(4-propan-2-ylphenyl)-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CC(C)c1ccc(-c2cc(C(F)(F)F)n3ncc(C(=O)Nc4cc(OCC(F)F)cc([N+](=O)[O-])c4)c3n2)cc1 |
| InChI | InChI=1S/C25H20F5N5O4/c1-13(2)14-3-5-15(6-4-14)20-10-21(25(28,29)30)34-23(33-20)19(11-31-34)24(36)32-16-7-17(35(37)38)9-18(8-16)39-12-22(26)27/h3-11,13,22H,12H2,1-2H3,(H,32,36) |
| InChIKey | VCMGYDFEZIBTDY-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.46 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|