C19H14F5N5O4 — CID 19447441
5-cyclopropyl-N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 19447441) has the molecular formula C19H14F5N5O4 and a molecular weight of 471.34 g/mol. Its IUPAC name is 5-cyclopropyl-N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 5-cyclopropyl-N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 19447441 |
| Molecular Formula | C19H14F5N5O4 |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 5-cyclopropyl-N-[3-(2,2-difluoroethoxy)-5-nitrophenyl]-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | O=C(Nc1cc(OCC(F)F)cc([N+](=O)[O-])c1)c1cc2nc(C3CC3)cc(C(F)(F)F)n2n1 |
| InChI | InChI=1S/C19H14F5N5O4/c20-16(21)8-33-12-4-10(3-11(5-12)29(31)32)25-18(30)14-7-17-26-13(9-1-2-9)6-15(19(22,23)24)28(17)27-14/h3-7,9,16H,1-2,8H2,(H,25,30) |
| InChIKey | UILJQPXPDWVUBD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|