C17H19FN6S — CID 19456256
3-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-1-methyl-1-[(1-methylpyrazol-3-yl)methyl]thiourea (PubChem CID 19456256) has the molecular formula C17H19FN6S and a molecular weight of 358.45 g/mol. Its IUPAC name is 3-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-1-methyl-1-[(1-methylpyrazol-3-yl)methyl]thiourea.
| Compound Name | 3-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-1-methyl-1-[(1-methylpyrazol-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 19456256 |
| Molecular Formula | C17H19FN6S |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 3-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-1-methyl-1-[(1-methylpyrazol-3-yl)methyl]thiourea |
| SMILES | CN(Cc1ccn(C)n1)C(=S)Nc1cnn(Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H19FN6S/c1-22(11-15-7-8-23(2)21-15)17(25)20-16-9-19-24(12-16)10-13-3-5-14(18)6-4-13/h3-9,12H,10-11H2,1-2H3,(H,20,25) |
| InChIKey | JCYNACUIOZHKGH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 50.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|