C21H29N3O — CID 19456559
(E)-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-methyl-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 19456559) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is (E)-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-methyl-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-methyl-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19456559 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | (E)-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-methyl-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CCn1nc(C)c(CN(C)C(=O)/C=C/c2ccc(C(C)C)cc2)c1C |
| InChI | InChI=1S/C21H29N3O/c1-7-24-17(5)20(16(4)22-24)14-23(6)21(25)13-10-18-8-11-19(12-9-18)15(2)3/h8-13,15H,7,14H2,1-6H3/b13-10+ |
| InChIKey | SRWKLPZFWHLFIU-JLHYYAGUSA-N |
| XLogP | 4.32 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|