C23H25N3O — CID 97428954
(Z)-N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methyl-3-(3-methylphenyl)prop-2-enamide (PubChem CID 97428954) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is (Z)-N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methyl-3-(3-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methyl-3-(3-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 97428954 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | (Z)-N-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-N-methyl-3-(3-methylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(/C=C\C(=O)N(C)Cc2c(C)nn(-c3ccccc3)c2C)c1 |
| InChI | InChI=1S/C23H25N3O/c1-17-9-8-10-20(15-17)13-14-23(27)25(4)16-22-18(2)24-26(19(22)3)21-11-6-5-7-12-21/h5-15H,16H2,1-4H3/b14-13- |
| InChIKey | CAWIJQPIXDALTQ-YPKPFQOOSA-N |
| XLogP | 4.47 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|