C15H21ClN6O3 — CID 19464691
N-[(4-chloro-1-ethylpyrazol-5-yl)methyl]-N-methyl-2-(5-methyl-3-nitropyrazol-1-yl)butanamide (PubChem CID 19464691) has the molecular formula C15H21ClN6O3 and a molecular weight of 368.83 g/mol. Its IUPAC name is N-[(4-chloro-1-ethylpyrazol-5-yl)methyl]-N-methyl-2-(5-methyl-3-nitropyrazol-1-yl)butanamide.
| Compound Name | N-[(4-chloro-1-ethylpyrazol-5-yl)methyl]-N-methyl-2-(5-methyl-3-nitropyrazol-1-yl)butanamide |
|---|---|
| PubChem CID | 19464691 |
| Molecular Formula | C15H21ClN6O3 |
| Molecular Weight | 368.83 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-[(4-chloro-1-ethylpyrazol-5-yl)methyl]-N-methyl-2-(5-methyl-3-nitropyrazol-1-yl)butanamide |
| SMILES | CCC(C(=O)N(C)Cc1c(Cl)cnn1CC)n1nc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C15H21ClN6O3/c1-5-12(21-10(3)7-14(18-21)22(24)25)15(23)19(4)9-13-11(16)8-17-20(13)6-2/h7-8,12H,5-6,9H2,1-4H3 |
| InChIKey | MOCFMHCJUKIKIZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 99.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.83 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|