C15H17F2N3O2 — CID 19466850
3-(difluoromethoxy)-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]benzamide (PubChem CID 19466850) has the molecular formula C15H17F2N3O2 and a molecular weight of 309.32 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]benzamide.
| Compound Name | 3-(difluoromethoxy)-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 19466850 |
| Molecular Formula | C15H17F2N3O2 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 3-(difluoromethoxy)-N-[1-(1,3-dimethylpyrazol-4-yl)ethyl]benzamide |
| SMILES | Cc1nn(C)cc1C(C)NC(=O)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C15H17F2N3O2/c1-9(13-8-20(3)19-10(13)2)18-14(21)11-5-4-6-12(7-11)22-15(16)17/h4-9,15H,1-3H3,(H,18,21) |
| InChIKey | YCCJTTTYWPYROY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |