C15H19N3O2 — CID 65191652
methyl 3-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]benzoate (PubChem CID 65191652) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is methyl 3-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]benzoate.
| Compound Name | methyl 3-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]benzoate |
|---|---|
| PubChem CID | 65191652 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | methyl 3-[1-(1,3-dimethylpyrazol-4-yl)ethylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(C)c2cn(C)nc2C)c1 |
| InChI | InChI=1S/C15H19N3O2/c1-10(14-9-18(3)17-11(14)2)16-13-7-5-6-12(8-13)15(19)20-4/h5-10,16H,1-4H3 |
| InChIKey | RGIMUWBWLVJNKE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |