C19H21NO6 — CID 19467659
ethyl (E)-3-[[5-[(2-methoxyphenoxy)methyl]furan-2-carbonyl]amino]but-2-enoate (PubChem CID 19467659) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is ethyl (E)-3-[[5-[(2-methoxyphenoxy)methyl]furan-2-carbonyl]amino]but-2-enoate.
| Compound Name | ethyl (E)-3-[[5-[(2-methoxyphenoxy)methyl]furan-2-carbonyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 19467659 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | ethyl (E)-3-[[5-[(2-methoxyphenoxy)methyl]furan-2-carbonyl]amino]but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)NC(=O)c1ccc(COc2ccccc2OC)o1 |
| InChI | InChI=1S/C19H21NO6/c1-4-24-18(21)11-13(2)20-19(22)17-10-9-14(26-17)12-25-16-8-6-5-7-15(16)23-3/h5-11H,4,12H2,1-3H3,(H,20,22)/b13-11+ |
| InChIKey | SSMDULZMDDXLGZ-ACCUITESSA-N |
| XLogP | 3.06 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|