C19H19F3N8O3 — CID 19472502
[1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazol-3-yl]-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methanone (PubChem CID 19472502) has the molecular formula C19H19F3N8O3 and a molecular weight of 464.41 g/mol. Its IUPAC name is [1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazol-3-yl]-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methanone.
| Compound Name | [1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazol-3-yl]-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19472502 |
| Molecular Formula | C19H19F3N8O3 |
| Molecular Weight | 464.41 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | [1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazol-3-yl]-[4-[[3-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccn(Cn2cnc([N+](=O)[O-])n2)n1)N1CCN(Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H19F3N8O3/c20-19(21,22)15-3-1-2-14(10-15)11-26-6-8-27(9-7-26)17(31)16-4-5-28(24-16)13-29-12-23-18(25-29)30(32)33/h1-5,10,12H,6-9,11,13H2 |
| InChIKey | AMIJPRNIGQPQNJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 115.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|