C27H32ClN5O — CID 19473781
3-(1-adamantyl)-N-[3-(4-chloro-3-methylpyrazol-1-yl)propyl]-1-phenylpyrazole-4-carboxamide (PubChem CID 19473781) has the molecular formula C27H32ClN5O and a molecular weight of 478.04 g/mol. Its IUPAC name is 3-(1-adamantyl)-N-[3-(4-chloro-3-methylpyrazol-1-yl)propyl]-1-phenylpyrazole-4-carboxamide.
| Compound Name | 3-(1-adamantyl)-N-[3-(4-chloro-3-methylpyrazol-1-yl)propyl]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 19473781 |
| Molecular Formula | C27H32ClN5O |
| Molecular Weight | 478.04 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 3-(1-adamantyl)-N-[3-(4-chloro-3-methylpyrazol-1-yl)propyl]-1-phenylpyrazole-4-carboxamide |
| SMILES | Cc1nn(CCCNC(=O)c2cn(-c3ccccc3)nc2C23CC4CC(CC(C4)C2)C3)cc1Cl |
| InChI | InChI=1S/C27H32ClN5O/c1-18-24(28)17-32(30-18)9-5-8-29-26(34)23-16-33(22-6-3-2-4-7-22)31-25(23)27-13-19-10-20(14-27)12-21(11-19)15-27/h2-4,6-7,16-17,19-21H,5,8-15H2,1H3,(H,29,34) |
| InChIKey | WGKGZXJOMCLBRU-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.04 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|