C28H35N5O — CID 19473710
3-(1-adamantyl)-N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]-1-phenylpyrazole-4-carboxamide (PubChem CID 19473710) has the molecular formula C28H35N5O and a molecular weight of 457.62 g/mol. Its IUPAC name is 3-(1-adamantyl)-N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]-1-phenylpyrazole-4-carboxamide.
| Compound Name | 3-(1-adamantyl)-N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 19473710 |
| Molecular Formula | C28H35N5O |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | 3-(1-adamantyl)-N-[1-(1-ethyl-3-methylpyrazol-4-yl)ethyl]-1-phenylpyrazole-4-carboxamide |
| SMILES | CCn1cc(C(C)NC(=O)c2cn(-c3ccccc3)nc2C23CC4CC(CC(C4)C2)C3)c(C)n1 |
| InChI | InChI=1S/C28H35N5O/c1-4-32-16-24(19(3)30-32)18(2)29-27(34)25-17-33(23-8-6-5-7-9-23)31-26(25)28-13-20-10-21(14-28)12-22(11-20)15-28/h5-9,16-18,20-22H,4,10-15H2,1-3H3,(H,29,34) |
| InChIKey | USDHBRSPOMWLMN-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |