C29H30N6O — CID 19473794
3-(1-adamantyl)-N-(1-benzyl-1,2,4-triazol-3-yl)-1-phenylpyrazole-4-carboxamide (PubChem CID 19473794) has the molecular formula C29H30N6O and a molecular weight of 478.60 g/mol. Its IUPAC name is 3-(1-adamantyl)-N-(1-benzyl-1,2,4-triazol-3-yl)-1-phenylpyrazole-4-carboxamide.
| Compound Name | 3-(1-adamantyl)-N-(1-benzyl-1,2,4-triazol-3-yl)-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 19473794 |
| Molecular Formula | C29H30N6O |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | 3-(1-adamantyl)-N-(1-benzyl-1,2,4-triazol-3-yl)-1-phenylpyrazole-4-carboxamide |
| SMILES | O=C(Nc1ncn(Cc2ccccc2)n1)c1cn(-c2ccccc2)nc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C29H30N6O/c36-27(31-28-30-19-34(33-28)17-20-7-3-1-4-8-20)25-18-35(24-9-5-2-6-10-24)32-26(25)29-14-21-11-22(15-29)13-23(12-21)16-29/h1-10,18-19,21-23H,11-17H2,(H,31,33,36) |
| InChIKey | HXHXTGUVGQKHRS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |