C25H20N6O — CID 19281399
N-(1-benzyl-1,2,4-triazol-3-yl)-1,3-diphenylpyrazole-4-carboxamide (PubChem CID 19281399) has the molecular formula C25H20N6O and a molecular weight of 420.48 g/mol. Its IUPAC name is N-(1-benzyl-1,2,4-triazol-3-yl)-1,3-diphenylpyrazole-4-carboxamide.
| Compound Name | N-(1-benzyl-1,2,4-triazol-3-yl)-1,3-diphenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 19281399 |
| Molecular Formula | C25H20N6O |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | N-(1-benzyl-1,2,4-triazol-3-yl)-1,3-diphenylpyrazole-4-carboxamide |
| SMILES | O=C(Nc1ncn(Cc2ccccc2)n1)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C25H20N6O/c32-24(27-25-26-18-30(29-25)16-19-10-4-1-5-11-19)22-17-31(21-14-8-3-9-15-21)28-23(22)20-12-6-2-7-13-20/h1-15,17-18H,16H2,(H,27,29,32) |
| InChIKey | CKQIFQARXLRLTI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |