C25H31N3O3S — CID 19473673
ethyl (2R)-2-[[3-(1-adamantyl)-1-phenylpyrazole-4-carbonyl]amino]-3-sulfanylpropanoate (PubChem CID 19473673) has the molecular formula C25H31N3O3S and a molecular weight of 453.61 g/mol. Its IUPAC name is ethyl (2R)-2-[[3-(1-adamantyl)-1-phenylpyrazole-4-carbonyl]amino]-3-sulfanylpropanoate.
| Compound Name | ethyl (2R)-2-[[3-(1-adamantyl)-1-phenylpyrazole-4-carbonyl]amino]-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 19473673 |
| Molecular Formula | C25H31N3O3S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | ethyl (2R)-2-[[3-(1-adamantyl)-1-phenylpyrazole-4-carbonyl]amino]-3-sulfanylpropanoate |
| SMILES | CCOC(=O)[C@H](CS)NC(=O)c1cn(-c2ccccc2)nc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H31N3O3S/c1-2-31-24(30)21(15-32)26-23(29)20-14-28(19-6-4-3-5-7-19)27-22(20)25-11-16-8-17(12-25)10-18(9-16)13-25/h3-7,14,16-18,21,32H,2,8-13,15H2,1H3,(H,26,29)/t16?,17?,18?,21-,25?/m0/s1 |
| InChIKey | XFKFIXHUBUYJAU-ZNWBTVJYSA-N |
| XLogP | 3.93 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|