C14H9Cl2N5O3S — CID 19496683
N-(3,5-dichloro-2-pyridinyl)-4-[(3-nitropyrazol-1-yl)methyl]thiophene-2-carboxamide (PubChem CID 19496683) has the molecular formula C14H9Cl2N5O3S and a molecular weight of 398.23 g/mol. Its IUPAC name is N-(3,5-dichloro-2-pyridinyl)-4-[(3-nitropyrazol-1-yl)methyl]thiophene-2-carboxamide.
| Compound Name | N-(3,5-dichloro-2-pyridinyl)-4-[(3-nitropyrazol-1-yl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19496683 |
| Molecular Formula | C14H9Cl2N5O3S |
| Molecular Weight | 398.23 g/mol |
| Exact Mass | 396.98 |
| IUPAC Name | N-(3,5-dichloro-2-pyridinyl)-4-[(3-nitropyrazol-1-yl)methyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ncc(Cl)cc1Cl)c1cc(Cn2ccc([N+](=O)[O-])n2)cs1 |
| InChI | InChI=1S/C14H9Cl2N5O3S/c15-9-4-10(16)13(17-5-9)18-14(22)11-3-8(7-25-11)6-20-2-1-12(19-20)21(23)24/h1-5,7H,6H2,(H,17,18,22) |
| InChIKey | QYOPDQPMVPBSLT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.23 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|