C16H10F5N5O3 — CID 19500424
1-methyl-4-[[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]carbamoyl]pyrazole-3-carboxylic acid (PubChem CID 19500424) has the molecular formula C16H10F5N5O3 and a molecular weight of 415.28 g/mol. Its IUPAC name is 1-methyl-4-[[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]carbamoyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-methyl-4-[[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]carbamoyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 19500424 |
| Molecular Formula | C16H10F5N5O3 |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 1-methyl-4-[[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]carbamoyl]pyrazole-3-carboxylic acid |
| SMILES | Cn1cc(C(=O)Nc2cnn(Cc3c(F)c(F)c(F)c(F)c3F)c2)c(C(=O)O)n1 |
| InChI | InChI=1S/C16H10F5N5O3/c1-25-4-8(14(24-25)16(28)29)15(27)23-6-2-22-26(3-6)5-7-9(17)11(19)13(21)12(20)10(7)18/h2-4H,5H2,1H3,(H,23,27)(H,28,29) |
| InChIKey | ZQDKQUAWOXGDOE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|