C19H15ClN4O6 — CID 19500742
2-[4-[[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]carbamoyl]pyrazol-1-yl]acetic acid (PubChem CID 19500742) has the molecular formula C19H15ClN4O6 and a molecular weight of 430.80 g/mol. Its IUPAC name is 2-[4-[[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]carbamoyl]pyrazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]carbamoyl]pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 19500742 |
| Molecular Formula | C19H15ClN4O6 |
| Molecular Weight | 430.80 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 2-[4-[[3-(4-chloro-2-methylphenoxy)-5-nitrophenyl]carbamoyl]pyrazol-1-yl]acetic acid |
| SMILES | Cc1cc(Cl)ccc1Oc1cc(NC(=O)c2cnn(CC(=O)O)c2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H15ClN4O6/c1-11-4-13(20)2-3-17(11)30-16-6-14(5-15(7-16)24(28)29)22-19(27)12-8-21-23(9-12)10-18(25)26/h2-9H,10H2,1H3,(H,22,27)(H,25,26) |
| InChIKey | DZPODXIZOOFHRD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.80 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|