C8H11F2N3O2 — CID 19506929
2-(difluoromethyl)-N-(2-methoxyethyl)pyrazole-3-carboxamide (PubChem CID 19506929) has the molecular formula C8H11F2N3O2 and a molecular weight of 219.19 g/mol. Its IUPAC name is 2-(difluoromethyl)-N-(2-methoxyethyl)pyrazole-3-carboxamide.
| Compound Name | 2-(difluoromethyl)-N-(2-methoxyethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19506929 |
| Molecular Formula | C8H11F2N3O2 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 2-(difluoromethyl)-N-(2-methoxyethyl)pyrazole-3-carboxamide |
| SMILES | COCCNC(=O)c1ccnn1C(F)F |
| InChI | InChI=1S/C8H11F2N3O2/c1-15-5-4-11-7(14)6-2-3-12-13(6)8(9)10/h2-3,8H,4-5H2,1H3,(H,11,14) |
| InChIKey | WSCCBZYVLOOOGB-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|