C18H32F2N4O — CID 19506830
2-(difluoromethyl)-N-[1-(dipentylamino)propan-2-yl]pyrazole-3-carboxamide (PubChem CID 19506830) has the molecular formula C18H32F2N4O and a molecular weight of 358.48 g/mol. Its IUPAC name is 2-(difluoromethyl)-N-[1-(dipentylamino)propan-2-yl]pyrazole-3-carboxamide.
| Compound Name | 2-(difluoromethyl)-N-[1-(dipentylamino)propan-2-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19506830 |
| Molecular Formula | C18H32F2N4O |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 2-(difluoromethyl)-N-[1-(dipentylamino)propan-2-yl]pyrazole-3-carboxamide |
| SMILES | CCCCCN(CCCCC)CC(C)NC(=O)c1ccnn1C(F)F |
| InChI | InChI=1S/C18H32F2N4O/c1-4-6-8-12-23(13-9-7-5-2)14-15(3)22-17(25)16-10-11-21-24(16)18(19)20/h10-11,15,18H,4-9,12-14H2,1-3H3,(H,22,25) |
| InChIKey | FYWAGWYFFNUQCB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|