C20H38N4O — CID 19534421
N-[1-(dipentylamino)propan-2-yl]-2-(4-methylpyrazol-1-yl)propanamide (PubChem CID 19534421) has the molecular formula C20H38N4O and a molecular weight of 350.55 g/mol. Its IUPAC name is N-[1-(dipentylamino)propan-2-yl]-2-(4-methylpyrazol-1-yl)propanamide.
| Compound Name | N-[1-(dipentylamino)propan-2-yl]-2-(4-methylpyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19534421 |
| Molecular Formula | C20H38N4O |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.30 |
| IUPAC Name | N-[1-(dipentylamino)propan-2-yl]-2-(4-methylpyrazol-1-yl)propanamide |
| SMILES | CCCCCN(CCCCC)CC(C)NC(=O)C(C)n1cc(C)cn1 |
| InChI | InChI=1S/C20H38N4O/c1-6-8-10-12-23(13-11-9-7-2)16-18(4)22-20(25)19(5)24-15-17(3)14-21-24/h14-15,18-19H,6-13,16H2,1-5H3,(H,22,25) |
| InChIKey | UUSYNQRLLPVWSO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|