C19H36N4O — CID 19475353
N-[1-(dipentylamino)propan-2-yl]-2-ethylpyrazole-3-carboxamide (PubChem CID 19475353) has the molecular formula C19H36N4O and a molecular weight of 336.52 g/mol. Its IUPAC name is N-[1-(dipentylamino)propan-2-yl]-2-ethylpyrazole-3-carboxamide.
| Compound Name | N-[1-(dipentylamino)propan-2-yl]-2-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19475353 |
| Molecular Formula | C19H36N4O |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.29 |
| IUPAC Name | N-[1-(dipentylamino)propan-2-yl]-2-ethylpyrazole-3-carboxamide |
| SMILES | CCCCCN(CCCCC)CC(C)NC(=O)c1ccnn1CC |
| InChI | InChI=1S/C19H36N4O/c1-5-8-10-14-22(15-11-9-6-2)16-17(4)21-19(24)18-12-13-20-23(18)7-3/h12-13,17H,5-11,14-16H2,1-4H3,(H,21,24) |
| InChIKey | VAGHNVRGLQSCTK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|