C23H40N6O — CID 19270531
1-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[1-(dipentylamino)propan-2-yl]pyrazole-3-carboxamide (PubChem CID 19270531) has the molecular formula C23H40N6O and a molecular weight of 416.61 g/mol. Its IUPAC name is 1-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[1-(dipentylamino)propan-2-yl]pyrazole-3-carboxamide.
| Compound Name | 1-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[1-(dipentylamino)propan-2-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19270531 |
| Molecular Formula | C23H40N6O |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.33 |
| IUPAC Name | 1-[(3,5-dimethylpyrazol-1-yl)methyl]-N-[1-(dipentylamino)propan-2-yl]pyrazole-3-carboxamide |
| SMILES | CCCCCN(CCCCC)CC(C)NC(=O)c1ccn(Cn2nc(C)cc2C)n1 |
| InChI | InChI=1S/C23H40N6O/c1-6-8-10-13-27(14-11-9-7-2)17-20(4)24-23(30)22-12-15-28(26-22)18-29-21(5)16-19(3)25-29/h12,15-16,20H,6-11,13-14,17-18H2,1-5H3,(H,24,30) |
| InChIKey | XDLMAAQIQHJGNJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|