C19H34N4O3 — CID 19502162
1-[2-[1-(dipentylamino)propan-2-ylamino]-2-oxoethyl]pyrazole-3-carboxylic acid (PubChem CID 19502162) has the molecular formula C19H34N4O3 and a molecular weight of 366.51 g/mol. Its IUPAC name is 1-[2-[1-(dipentylamino)propan-2-ylamino]-2-oxoethyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-[2-[1-(dipentylamino)propan-2-ylamino]-2-oxoethyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 19502162 |
| Molecular Formula | C19H34N4O3 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | 1-[2-[1-(dipentylamino)propan-2-ylamino]-2-oxoethyl]pyrazole-3-carboxylic acid |
| SMILES | CCCCCN(CCCCC)CC(C)NC(=O)Cn1ccc(C(=O)O)n1 |
| InChI | InChI=1S/C19H34N4O3/c1-4-6-8-11-22(12-9-7-5-2)14-16(3)20-18(24)15-23-13-10-17(21-23)19(25)26/h10,13,16H,4-9,11-12,14-15H2,1-3H3,(H,20,24)(H,25,26) |
| InChIKey | AWQIRXGCQYMFRN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|