C20H35F3N4O — CID 19521888
N-[1-(dipentylamino)propan-2-yl]-2-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 19521888) has the molecular formula C20H35F3N4O and a molecular weight of 404.52 g/mol. Its IUPAC name is N-[1-(dipentylamino)propan-2-yl]-2-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-[1-(dipentylamino)propan-2-yl]-2-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 19521888 |
| Molecular Formula | C20H35F3N4O |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | N-[1-(dipentylamino)propan-2-yl]-2-[3-methyl-5-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | CCCCCN(CCCCC)CC(C)NC(=O)Cn1nc(C)cc1C(F)(F)F |
| InChI | InChI=1S/C20H35F3N4O/c1-5-7-9-11-26(12-10-8-6-2)14-17(4)24-19(28)15-27-18(20(21,22)23)13-16(3)25-27/h13,17H,5-12,14-15H2,1-4H3,(H,24,28) |
| InChIKey | CZIDIMCYXDQLHS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|