C20H35ClF2N4O — CID 19517493
2-[4-chloro-3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-[1-(dipentylamino)propan-2-yl]acetamide (PubChem CID 19517493) has the molecular formula C20H35ClF2N4O and a molecular weight of 420.98 g/mol. Its IUPAC name is 2-[4-chloro-3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-[1-(dipentylamino)propan-2-yl]acetamide.
| Compound Name | 2-[4-chloro-3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-[1-(dipentylamino)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 19517493 |
| Molecular Formula | C20H35ClF2N4O |
| Molecular Weight | 420.98 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | 2-[4-chloro-3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-[1-(dipentylamino)propan-2-yl]acetamide |
| SMILES | CCCCCN(CCCCC)CC(C)NC(=O)Cn1nc(C(F)F)c(Cl)c1C |
| InChI | InChI=1S/C20H35ClF2N4O/c1-5-7-9-11-26(12-10-8-6-2)13-15(3)24-17(28)14-27-16(4)18(21)19(25-27)20(22)23/h15,20H,5-14H2,1-4H3,(H,24,28) |
| InChIKey | ASEZFAPOIUVBJS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.98 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|