C20H33N5O — CID 19414546
N-[1-(dipentylamino)propan-2-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 19414546) has the molecular formula C20H33N5O and a molecular weight of 359.52 g/mol. Its IUPAC name is N-[1-(dipentylamino)propan-2-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-[1-(dipentylamino)propan-2-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 19414546 |
| Molecular Formula | C20H33N5O |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.27 |
| IUPAC Name | N-[1-(dipentylamino)propan-2-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | CCCCCN(CCCCC)CC(C)NC(=O)c1cnn2cccnc12 |
| InChI | InChI=1S/C20H33N5O/c1-4-6-8-12-24(13-9-7-5-2)16-17(3)23-20(26)18-15-22-25-14-10-11-21-19(18)25/h10-11,14-15,17H,4-9,12-13,16H2,1-3H3,(H,23,26) |
| InChIKey | RFJCFMFNXDDWPU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|