C28H23N5O4 — CID 19518661
2-(1-ethylpyrazol-4-yl)-N-[3-(2-methylphenoxy)-5-nitrophenyl]quinoline-4-carboxamide (PubChem CID 19518661) has the molecular formula C28H23N5O4 and a molecular weight of 493.52 g/mol. Its IUPAC name is 2-(1-ethylpyrazol-4-yl)-N-[3-(2-methylphenoxy)-5-nitrophenyl]quinoline-4-carboxamide.
| Compound Name | 2-(1-ethylpyrazol-4-yl)-N-[3-(2-methylphenoxy)-5-nitrophenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 19518661 |
| Molecular Formula | C28H23N5O4 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 2-(1-ethylpyrazol-4-yl)-N-[3-(2-methylphenoxy)-5-nitrophenyl]quinoline-4-carboxamide |
| SMILES | CCn1cc(-c2cc(C(=O)Nc3cc(Oc4ccccc4C)cc([N+](=O)[O-])c3)c3ccccc3n2)cn1 |
| InChI | InChI=1S/C28H23N5O4/c1-3-32-17-19(16-29-32)26-15-24(23-9-5-6-10-25(23)31-26)28(34)30-20-12-21(33(35)36)14-22(13-20)37-27-11-7-4-8-18(27)2/h4-17H,3H2,1-2H3,(H,30,34) |
| InChIKey | VVZMIRJEUQCIPH-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|