C30H27N5O4 — CID 19511520
N-[3-(3,5-dimethylphenoxy)-5-nitrophenyl]-2-(1-ethyl-3-methylpyrazol-4-yl)quinoline-4-carboxamide (PubChem CID 19511520) has the molecular formula C30H27N5O4 and a molecular weight of 521.58 g/mol. Its IUPAC name is N-[3-(3,5-dimethylphenoxy)-5-nitrophenyl]-2-(1-ethyl-3-methylpyrazol-4-yl)quinoline-4-carboxamide.
| Compound Name | N-[3-(3,5-dimethylphenoxy)-5-nitrophenyl]-2-(1-ethyl-3-methylpyrazol-4-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 19511520 |
| Molecular Formula | C30H27N5O4 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | N-[3-(3,5-dimethylphenoxy)-5-nitrophenyl]-2-(1-ethyl-3-methylpyrazol-4-yl)quinoline-4-carboxamide |
| SMILES | CCn1cc(-c2cc(C(=O)Nc3cc(Oc4cc(C)cc(C)c4)cc([N+](=O)[O-])c3)c3ccccc3n2)c(C)n1 |
| InChI | InChI=1S/C30H27N5O4/c1-5-34-17-27(20(4)33-34)29-16-26(25-8-6-7-9-28(25)32-29)30(36)31-21-13-22(35(37)38)15-24(14-21)39-23-11-18(2)10-19(3)12-23/h6-17H,5H2,1-4H3,(H,31,36) |
| InChIKey | WQRISIAQCKEDNN-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|